C12H4ClF3N2O — CID 59225817
3-chloro-5-[(2,3,6-trifluoro-4-pyridinyl)oxy]benzonitrile (PubChem CID 59225817) has the molecular formula C12H4ClF3N2O and a molecular weight of 284.62 g/mol. Its IUPAC name is 3-chloro-5-[(2,3,6-trifluoro-4-pyridinyl)oxy]benzonitrile.
| Compound Name | 3-chloro-5-[(2,3,6-trifluoro-4-pyridinyl)oxy]benzonitrile |
|---|---|
| PubChem CID | 59225817 |
| Molecular Formula | C12H4ClF3N2O |
| Molecular Weight | 284.62 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 3-chloro-5-[(2,3,6-trifluoro-4-pyridinyl)oxy]benzonitrile |
| SMILES | N#Cc1cc(Cl)cc(Oc2cc(F)nc(F)c2F)c1 |
| InChI | InChI=1S/C12H4ClF3N2O/c13-7-1-6(5-17)2-8(3-7)19-9-4-10(14)18-12(16)11(9)15/h1-4H |
| InChIKey | DYVFDCJQXGUQAT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|