C29H41NO7 — CID 59226868
[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (E)-3-[4-[2-(2-hydroxyethoxy)ethylamino]phenyl]prop-2-enoate (PubChem CID 59226868) has the molecular formula C29H41NO7 and a molecular weight of 515.65 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (E)-3-[4-[2-(2-hydroxyethoxy)ethylamino]phenyl]prop-2-enoate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (E)-3-[4-[2-(2-hydroxyethoxy)ethylamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 59226868 |
| Molecular Formula | C29H41NO7 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (E)-3-[4-[2-(2-hydroxyethoxy)ethylamino]phenyl]prop-2-enoate |
| SMILES | CO[C@@H]1[C@H](OC(=O)/C=C/c2ccc(NCCOCCO)cc2)CC[C@]2(CO2)[C@H]1[C@@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C29H41NO7/c1-20(2)5-11-24-28(3,37-24)27-26(33-4)23(13-14-29(27)19-35-29)36-25(32)12-8-21-6-9-22(10-7-21)30-15-17-34-18-16-31/h5-10,12,23-24,26-27,30-31H,11,13-19H2,1-4H3/b12-8+/t23-,24-,26-,27-,28+,29+/m1/s1 |
| InChIKey | RVHLGUMBOKPXFY-NJBODVCTSA-N |
| XLogP | 3.74 |
| TPSA | 102.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|