C33H40O8 — CID 90746346
[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-[4-[4-(hydroxymethyl)phenoxy]-3-methoxyphenyl]prop-2-enoate (PubChem CID 90746346) has the molecular formula C33H40O8 and a molecular weight of 564.68 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-[4-[4-(hydroxymethyl)phenoxy]-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-[4-[4-(hydroxymethyl)phenoxy]-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 90746346 |
| Molecular Formula | C33H40O8 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-[4-[4-(hydroxymethyl)phenoxy]-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)O[C@@H]2CC[C@]3(CO3)[C@@H]([C@@]3(C)O[C@@H]3CC=C(C)C)[C@@H]2OC)ccc1Oc1ccc(CO)cc1 |
| InChI | InChI=1S/C33H40O8/c1-21(2)6-14-28-32(3,41-28)31-30(37-5)26(16-17-33(31)20-38-33)40-29(35)15-10-22-9-13-25(27(18-22)36-4)39-24-11-7-23(19-34)8-12-24/h6-13,15,18,26,28,30-31,34H,14,16-17,19-20H2,1-5H3/t26-,28-,30-,31-,32+,33+/m1/s1 |
| InChIKey | GBFPQJQCQDFGDA-AOZDHYIWSA-N |
| XLogP | 5.61 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|