C29H40O9 — CID 11584600
[(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (E)-3-[4-(2-hydroxyethoxy)-3,5-dimethoxyphenyl]prop-2-enoate (PubChem CID 11584600) has the molecular formula C29H40O9 and a molecular weight of 532.63 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (E)-3-[4-(2-hydroxyethoxy)-3,5-dimethoxyphenyl]prop-2-enoate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (E)-3-[4-(2-hydroxyethoxy)-3,5-dimethoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 11584600 |
| Molecular Formula | C29H40O9 |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (E)-3-[4-(2-hydroxyethoxy)-3,5-dimethoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H]2CC[C@]3(CO3)[C@@H]([C@]3(C)O[C@@H]3CC=C(C)C)[C@@H]2OC)cc(OC)c1OCCO |
| InChI | InChI=1S/C29H40O9/c1-18(2)7-9-23-28(3,38-23)27-26(34-6)20(11-12-29(27)17-36-29)37-24(31)10-8-19-15-21(32-4)25(35-14-13-30)22(16-19)33-5/h7-8,10,15-16,20,23,26-27,30H,9,11-14,17H2,1-6H3/b10-8+/t20-,23-,26-,27-,28-,29+/m1/s1 |
| InChIKey | QEXNPLDHGBEMEI-CFXNQBFSSA-N |
| XLogP | 3.71 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|