C33H40O7 — CID 126539416
[(3R,5S,6R)-5-methoxy-4-[(2S,3S)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (E)-3-[4-[4-(methoxymethyl)phenoxy]phenyl]prop-2-enoate (PubChem CID 126539416) has the molecular formula C33H40O7 and a molecular weight of 548.68 g/mol. Its IUPAC name is [(3R,5S,6R)-5-methoxy-4-[(2S,3S)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (E)-3-[4-[4-(methoxymethyl)phenoxy]phenyl]prop-2-enoate.
| Compound Name | [(3R,5S,6R)-5-methoxy-4-[(2S,3S)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (E)-3-[4-[4-(methoxymethyl)phenoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 126539416 |
| Molecular Formula | C33H40O7 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | [(3R,5S,6R)-5-methoxy-4-[(2S,3S)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (E)-3-[4-[4-(methoxymethyl)phenoxy]phenyl]prop-2-enoate |
| SMILES | COCc1ccc(Oc2ccc(/C=C/C(=O)O[C@@H]3CC[C@]4(CO4)C(C4(C)O[C@H]4CC=C(C)C)[C@@H]3OC)cc2)cc1 |
| InChI | InChI=1S/C33H40O7/c1-22(2)6-16-28-32(3,40-28)31-30(36-5)27(18-19-33(31)21-37-33)39-29(34)17-11-23-7-12-25(13-8-23)38-26-14-9-24(10-15-26)20-35-4/h6-15,17,27-28,30-31H,16,18-21H2,1-5H3/b17-11+/t27-,28+,30-,31?,32?,33+/m1/s1 |
| InChIKey | TWLYAMZRRMBNQY-VDPHEMIXSA-N |
| XLogP | 6.26 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|