C34H42O9 — CID 59226888
[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (E)-3-[4-[4-(hydroxymethyl)phenoxy]-3,5-dimethoxyphenyl]prop-2-enoate (PubChem CID 59226888) has the molecular formula C34H42O9 and a molecular weight of 594.70 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (E)-3-[4-[4-(hydroxymethyl)phenoxy]-3,5-dimethoxyphenyl]prop-2-enoate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (E)-3-[4-[4-(hydroxymethyl)phenoxy]-3,5-dimethoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 59226888 |
| Molecular Formula | C34H42O9 |
| Molecular Weight | 594.70 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (E)-3-[4-[4-(hydroxymethyl)phenoxy]-3,5-dimethoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H]2CC[C@]3(CO3)[C@@H]([C@@]3(C)O[C@@H]3CC=C(C)C)[C@@H]2OC)cc(OC)c1Oc1ccc(CO)cc1 |
| InChI | InChI=1S/C34H42O9/c1-21(2)7-13-28-33(3,43-28)32-31(39-6)25(15-16-34(32)20-40-34)42-29(36)14-10-23-17-26(37-4)30(27(18-23)38-5)41-24-11-8-22(19-35)9-12-24/h7-12,14,17-18,25,28,31-32,35H,13,15-16,19-20H2,1-6H3/b14-10+/t25-,28-,31-,32-,33+,34+/m1/s1 |
| InChIKey | LNKALCVEFNLKHN-BEPKFLMWSA-N |
| XLogP | 5.62 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.70 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|