C25H39N5 — CID 59229945
N-[(4-aminocyclohexyl)methyl]-N'-ethyl-N'-[3-(4-pyrimidin-2-ylphenyl)propyl]propane-1,3-diamine (PubChem CID 59229945) has the molecular formula C25H39N5 and a molecular weight of 409.62 g/mol. Its IUPAC name is N-[(4-aminocyclohexyl)methyl]-N'-ethyl-N'-[3-(4-pyrimidin-2-ylphenyl)propyl]propane-1,3-diamine.
| Compound Name | N-[(4-aminocyclohexyl)methyl]-N'-ethyl-N'-[3-(4-pyrimidin-2-ylphenyl)propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 59229945 |
| Molecular Formula | C25H39N5 |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.32 |
| IUPAC Name | N-[(4-aminocyclohexyl)methyl]-N'-ethyl-N'-[3-(4-pyrimidin-2-ylphenyl)propyl]propane-1,3-diamine |
| SMILES | CCN(CCCNCC1CCC(N)CC1)CCCc1ccc(-c2ncccn2)cc1 |
| InChI | InChI=1S/C25H39N5/c1-2-30(19-5-15-27-20-22-9-13-24(26)14-10-22)18-3-6-21-7-11-23(12-8-21)25-28-16-4-17-29-25/h4,7-8,11-12,16-17,22,24,27H,2-3,5-6,9-10,13-15,18-20,26H2,1H3 |
| InChIKey | GPBQLUIELLMTQZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|