C23H35N5 — CID 70840195
N-[(4-aminocyclohexyl)methyl]-N'-ethyl-N'-[(4-pyrimidin-2-ylphenyl)methyl]propane-1,3-diamine (PubChem CID 70840195) has the molecular formula C23H35N5 and a molecular weight of 381.57 g/mol. Its IUPAC name is N-[(4-aminocyclohexyl)methyl]-N'-ethyl-N'-[(4-pyrimidin-2-ylphenyl)methyl]propane-1,3-diamine.
| Compound Name | N-[(4-aminocyclohexyl)methyl]-N'-ethyl-N'-[(4-pyrimidin-2-ylphenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 70840195 |
| Molecular Formula | C23H35N5 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.29 |
| IUPAC Name | N-[(4-aminocyclohexyl)methyl]-N'-ethyl-N'-[(4-pyrimidin-2-ylphenyl)methyl]propane-1,3-diamine |
| SMILES | CCN(CCCNCC1CCC(N)CC1)Cc1ccc(-c2ncccn2)cc1 |
| InChI | InChI=1S/C23H35N5/c1-2-28(16-4-13-25-17-19-7-11-22(24)12-8-19)18-20-5-9-21(10-6-20)23-26-14-3-15-27-23/h3,5-6,9-10,14-15,19,22,25H,2,4,7-8,11-13,16-18,24H2,1H3 |
| InChIKey | CWPGVQVUPZJVIF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|