C22H37N3O3S — CID 59231550
4-[[4-(tert-butylsulfonylamino)cyclohexyl]methylamino]-3-methyl-N-propan-2-ylbenzamide (PubChem CID 59231550) has the molecular formula C22H37N3O3S and a molecular weight of 423.62 g/mol. Its IUPAC name is 4-[[4-(tert-butylsulfonylamino)cyclohexyl]methylamino]-3-methyl-N-propan-2-ylbenzamide.
| Compound Name | 4-[[4-(tert-butylsulfonylamino)cyclohexyl]methylamino]-3-methyl-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 59231550 |
| Molecular Formula | C22H37N3O3S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 4-[[4-(tert-butylsulfonylamino)cyclohexyl]methylamino]-3-methyl-N-propan-2-ylbenzamide |
| SMILES | Cc1cc(C(=O)NC(C)C)ccc1NCC1CCC(NS(=O)(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C22H37N3O3S/c1-15(2)24-21(26)18-9-12-20(16(3)13-18)23-14-17-7-10-19(11-8-17)25-29(27,28)22(4,5)6/h9,12-13,15,17,19,23,25H,7-8,10-11,14H2,1-6H3,(H,24,26) |
| InChIKey | FBBLIKCTZZGCJY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |