C21H35N3OS — CID 59231644
4-[[4-(tert-butylsulfanylamino)cyclohexyl]methylamino]-N-propan-2-ylbenzamide (PubChem CID 59231644) has the molecular formula C21H35N3OS and a molecular weight of 377.60 g/mol. Its IUPAC name is 4-[[4-(tert-butylsulfanylamino)cyclohexyl]methylamino]-N-propan-2-ylbenzamide.
| Compound Name | 4-[[4-(tert-butylsulfanylamino)cyclohexyl]methylamino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 59231644 |
| Molecular Formula | C21H35N3OS |
| Molecular Weight | 377.60 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 4-[[4-(tert-butylsulfanylamino)cyclohexyl]methylamino]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(NCC2CCC(NSC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H35N3OS/c1-15(2)23-20(25)17-8-12-18(13-9-17)22-14-16-6-10-19(11-7-16)24-26-21(3,4)5/h8-9,12-13,15-16,19,22,24H,6-7,10-11,14H2,1-5H3,(H,23,25) |
| InChIKey | QBMTUQIYJRLDOU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|