C11H16S2 — CID 592347
spiro[1,3-dithiolane-2,2'-1,4,5,6,7,7a-hexahydroindene] (PubChem CID 592347) has the molecular formula C11H16S2 and a molecular weight of 212.38 g/mol. Its IUPAC name is spiro[1,3-dithiolane-2,2'-1,4,5,6,7,7a-hexahydroindene].
| Compound Name | spiro[1,3-dithiolane-2,2'-1,4,5,6,7,7a-hexahydroindene] |
|---|---|
| PubChem CID | 592347 |
| Molecular Formula | C11H16S2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | spiro[1,3-dithiolane-2,2'-1,4,5,6,7,7a-hexahydroindene] |
| SMILES | C1=C2CCCCC2CC12SCCS2 |
| InChI | InChI=1S/C11H16S2/c1-2-4-10-8-11(7-9(10)3-1)12-5-6-13-11/h7,10H,1-6,8H2 |
| InChIKey | DYGDTURBAVEMSL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|