C78H71F2N2Si2 — CID 59246251
CID 59246251 (PubChem CID 59246251) has the molecular formula C78H71F2N2Si2 and a molecular weight of 1130.61 g/mol.
| Compound Name | CID 59246251 |
|---|---|
| PubChem CID | 59246251 |
| Molecular Formula | C78H71F2N2Si2 |
| Molecular Weight | 1130.61 g/mol |
| Exact Mass | 1129.51 |
| IUPAC Name | — |
| SMILES | C[Si](C)c1ccc(N(c2ccc(F)cc2)c2ccc3c(c2)C(C)(C)c2cc(/C=C/c4ccc5c(c4)C(C)(C)c4cc(/C=C/c6ccc7c(c6)C(C)(C)c6cc(N(c8ccc(F)cc8)c8ccc([Si](C)(C)C)cc8)ccc6-7)ccc4-5)ccc2-3)cc1 |
| InChI | InChI=1S/C78H71F2N2Si2/c1-76(2)70-44-50(12-14-52-18-40-66-68-42-32-60(48-74(68)77(3,4)72(66)46-52)81(56-24-20-54(79)21-25-56)58-28-34-62(35-29-58)83(7)8)16-38-64(70)65-39-17-51(45-71(65)76)13-15-53-19-41-67-69-43-33-61(49-75(69)78(5,6)73(67)47-53)82(57-26-22-55(80)23-27-57)59-30-36-63(37-31-59)84(9,10)11/h12-49H,1-11H3/b14-12+,15-13+ |
| InChIKey | LLKMELDLKCUDER-QUMQEAAQSA-N |
| XLogP | 20.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1130.61 |
| LogP ≤ 5 | 20.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|