C24H23N3O — CID 59248268
(2-phenoxyphenyl)-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]diazene (PubChem CID 59248268) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is (2-phenoxyphenyl)-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]diazene.
| Compound Name | (2-phenoxyphenyl)-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]diazene |
|---|---|
| PubChem CID | 59248268 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (2-phenoxyphenyl)-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]diazene |
| SMILES | CN1/C(=C/N=N/c2ccccc2Oc2ccccc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C24H23N3O/c1-24(2)19-13-7-9-15-21(19)27(3)23(24)17-25-26-20-14-8-10-16-22(20)28-18-11-5-4-6-12-18/h4-17H,1-3H3/b23-17+,26-25+ |
| InChIKey | MDDXEJJKBSINFX-AOUVVKEYSA-N |
| XLogP | 6.83 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|