C12H25NOS2 — CID 59253371
(2R)-2-amino-4-methyl-1-(4-methylpentyldisulfanyl)pentan-3-one (PubChem CID 59253371) has the molecular formula C12H25NOS2 and a molecular weight of 263.47 g/mol. Its IUPAC name is (2R)-2-amino-4-methyl-1-(4-methylpentyldisulfanyl)pentan-3-one.
| Compound Name | (2R)-2-amino-4-methyl-1-(4-methylpentyldisulfanyl)pentan-3-one |
|---|---|
| PubChem CID | 59253371 |
| Molecular Formula | C12H25NOS2 |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | (2R)-2-amino-4-methyl-1-(4-methylpentyldisulfanyl)pentan-3-one |
| SMILES | CC(C)CCCSSC[C@H](N)C(=O)C(C)C |
| InChI | InChI=1S/C12H25NOS2/c1-9(2)6-5-7-15-16-8-11(13)12(14)10(3)4/h9-11H,5-8,13H2,1-4H3/t11-/m0/s1 |
| InChIKey | HCKHRDUPLQKYSY-NSHDSACASA-N |
| XLogP | 3.36 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|