C21H26NO5S2Si- — CID 59262456
1-(benzenesulfonyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]indole-2-sulfinate (PubChem CID 59262456) has the molecular formula C21H26NO5S2Si- and a molecular weight of 464.66 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]indole-2-sulfinate.
| Compound Name | 1-(benzenesulfonyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]indole-2-sulfinate |
|---|---|
| PubChem CID | 59262456 |
| Molecular Formula | C21H26NO5S2Si- |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 1-(benzenesulfonyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]indole-2-sulfinate |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc2cc(S(=O)[O-])n(S(=O)(=O)c3ccccc3)c2c1 |
| InChI | InChI=1S/C21H27NO5S2Si/c1-21(2,3)30(4,5)27-15-16-11-12-17-14-20(28(23)24)22(19(17)13-16)29(25,26)18-9-7-6-8-10-18/h6-14H,15H2,1-5H3,(H,23,24)/p-1 |
| InChIKey | MSZYRYXLGWVYFS-UHFFFAOYSA-M |
| XLogP | 4.64 |
| TPSA | 88.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|