C17H8F5NO2 — CID 59264015
(4-cyano-3-fluorophenyl) 3-(2,6-difluoro-4-methylphenyl)-2,3-difluoroprop-2-enoate (PubChem CID 59264015) has the molecular formula C17H8F5NO2 and a molecular weight of 353.25 g/mol. Its IUPAC name is (4-cyano-3-fluorophenyl) 3-(2,6-difluoro-4-methylphenyl)-2,3-difluoroprop-2-enoate.
| Compound Name | (4-cyano-3-fluorophenyl) 3-(2,6-difluoro-4-methylphenyl)-2,3-difluoroprop-2-enoate |
|---|---|
| PubChem CID | 59264015 |
| Molecular Formula | C17H8F5NO2 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | (4-cyano-3-fluorophenyl) 3-(2,6-difluoro-4-methylphenyl)-2,3-difluoroprop-2-enoate |
| SMILES | Cc1cc(F)c(C(F)=C(F)C(=O)Oc2ccc(C#N)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C17H8F5NO2/c1-8-4-12(19)14(13(20)5-8)15(21)16(22)17(24)25-10-3-2-9(7-23)11(18)6-10/h2-6H,1H3 |
| InChIKey | MQSFLGNHWUATKC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|