C17H20NO3PS — CID 59264472
7-methoxy-4-[methoxy(phenyl)phosphoryl]-3,5-dihydro-2H-1,4-benzothiazepine (PubChem CID 59264472) has the molecular formula C17H20NO3PS and a molecular weight of 349.39 g/mol. Its IUPAC name is 7-methoxy-4-[methoxy(phenyl)phosphoryl]-3,5-dihydro-2H-1,4-benzothiazepine.
| Compound Name | 7-methoxy-4-[methoxy(phenyl)phosphoryl]-3,5-dihydro-2H-1,4-benzothiazepine |
|---|---|
| PubChem CID | 59264472 |
| Molecular Formula | C17H20NO3PS |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 7-methoxy-4-[methoxy(phenyl)phosphoryl]-3,5-dihydro-2H-1,4-benzothiazepine |
| SMILES | COc1ccc2c(c1)CN(P(=O)(OC)c1ccccc1)CCS2 |
| InChI | InChI=1S/C17H20NO3PS/c1-20-15-8-9-17-14(12-15)13-18(10-11-23-17)22(19,21-2)16-6-4-3-5-7-16/h3-9,12H,10-11,13H2,1-2H3 |
| InChIKey | ABUFHFOAYXAOQU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|