C27H32Cl3N3O — CID 59265745
(2-chloro-4-pyridinyl)-[4-[10-[(3,4-dichlorophenyl)methyl]-7-azaspiro[4.5]decan-7-yl]piperidin-1-yl]methanone (PubChem CID 59265745) has the molecular formula C27H32Cl3N3O and a molecular weight of 520.93 g/mol. Its IUPAC name is (2-chloro-4-pyridinyl)-[4-[10-[(3,4-dichlorophenyl)methyl]-7-azaspiro[4.5]decan-7-yl]piperidin-1-yl]methanone.
| Compound Name | (2-chloro-4-pyridinyl)-[4-[10-[(3,4-dichlorophenyl)methyl]-7-azaspiro[4.5]decan-7-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 59265745 |
| Molecular Formula | C27H32Cl3N3O |
| Molecular Weight | 520.93 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | (2-chloro-4-pyridinyl)-[4-[10-[(3,4-dichlorophenyl)methyl]-7-azaspiro[4.5]decan-7-yl]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccnc(Cl)c1)N1CCC(N2CCC(Cc3ccc(Cl)c(Cl)c3)C3(CCCC3)C2)CC1 |
| InChI | InChI=1S/C27H32Cl3N3O/c28-23-4-3-19(16-24(23)29)15-21-6-12-33(18-27(21)9-1-2-10-27)22-7-13-32(14-8-22)26(34)20-5-11-31-25(30)17-20/h3-5,11,16-17,21-22H,1-2,6-10,12-15,18H2 |
| InChIKey | LQPIQCIWNZKTJR-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.93 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|