C37H36N2O4S2 — CID 59269957
benzyl 12-[3-(5-methylsulfanylpentylsulfanyl)propyl]-7,14-dioxoquinolino[2,3-b]acridine-5-carboxylate (PubChem CID 59269957) has the molecular formula C37H36N2O4S2 and a molecular weight of 636.84 g/mol. Its IUPAC name is benzyl 12-[3-(5-methylsulfanylpentylsulfanyl)propyl]-7,14-dioxoquinolino[2,3-b]acridine-5-carboxylate.
| Compound Name | benzyl 12-[3-(5-methylsulfanylpentylsulfanyl)propyl]-7,14-dioxoquinolino[2,3-b]acridine-5-carboxylate |
|---|---|
| PubChem CID | 59269957 |
| Molecular Formula | C37H36N2O4S2 |
| Molecular Weight | 636.84 g/mol |
| Exact Mass | 636.21 |
| IUPAC Name | benzyl 12-[3-(5-methylsulfanylpentylsulfanyl)propyl]-7,14-dioxoquinolino[2,3-b]acridine-5-carboxylate |
| SMILES | CSCCCCCSCCCn1c2ccccc2c(=O)c2cc3c(cc21)c(=O)c1ccccc1n3C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H36N2O4S2/c1-44-20-10-3-11-21-45-22-12-19-38-31-17-8-6-15-27(31)35(40)29-24-34-30(23-33(29)38)36(41)28-16-7-9-18-32(28)39(34)37(42)43-25-26-13-4-2-5-14-26/h2,4-9,13-18,23-24H,3,10-12,19-22,25H2,1H3 |
| InChIKey | WNZLZTODCCAAIB-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.84 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|