C30H47O3- — CID 59271331
(5E,10E)-13-(8a-ethyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-2,6,10-trimethyltrideca-5,10-dienoate (PubChem CID 59271331) has the molecular formula C30H47O3- and a molecular weight of 455.70 g/mol. Its IUPAC name is (5E,10E)-13-(8a-ethyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-2,6,10-trimethyltrideca-5,10-dienoate.
| Compound Name | (5E,10E)-13-(8a-ethyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-2,6,10-trimethyltrideca-5,10-dienoate |
|---|---|
| PubChem CID | 59271331 |
| Molecular Formula | C30H47O3- |
| Molecular Weight | 455.70 g/mol |
| Exact Mass | 455.35 |
| IUPAC Name | (5E,10E)-13-(8a-ethyl-2,7,8-trimethyl-4,8-dihydro-3H-chromen-2-yl)-2,6,10-trimethyltrideca-5,10-dienoate |
| SMILES | CCC12OC(C)(CC/C=C(\C)CCC/C(C)=C/CCC(C)C(=O)[O-])CCC1=CC=C(C)C2C |
| InChI | InChI=1S/C30H48O3/c1-8-30-26(6)24(4)17-18-27(30)19-21-29(7,33-30)20-11-15-23(3)13-9-12-22(2)14-10-16-25(5)28(31)32/h14-15,17-18,25-26H,8-13,16,19-21H2,1-7H3,(H,31,32)/p-1/b22-14+,23-15+ |
| InChIKey | OOCFLTYIXTWXEY-HOFJZWJUSA-M |
| XLogP | 7.24 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.70 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|