C31H41F3N4O4 — CID 59277947
(6R,9R,12S)-9-propan-2-yl-12-propyl-6-[[4-(trifluoromethyl)phenyl]methyl]-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione (PubChem CID 59277947) has the molecular formula C31H41F3N4O4 and a molecular weight of 590.69 g/mol. Its IUPAC name is (6R,9R,12S)-9-propan-2-yl-12-propyl-6-[[4-(trifluoromethyl)phenyl]methyl]-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione.
| Compound Name | (6R,9R,12S)-9-propan-2-yl-12-propyl-6-[[4-(trifluoromethyl)phenyl]methyl]-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
|---|---|
| PubChem CID | 59277947 |
| Molecular Formula | C31H41F3N4O4 |
| Molecular Weight | 590.69 g/mol |
| Exact Mass | 590.31 |
| IUPAC Name | (6R,9R,12S)-9-propan-2-yl-12-propyl-6-[[4-(trifluoromethyl)phenyl]methyl]-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
| SMILES | CCC[C@@H]1NC(=O)[C@@H](C(C)C)NC(=O)[C@@H](Cc2ccc(C(F)(F)F)cc2)NCCOc2ccccc2CCCNC1=O |
| InChI | InChI=1S/C31H41F3N4O4/c1-4-8-24-28(39)36-16-7-10-22-9-5-6-11-26(22)42-18-17-35-25(29(40)38-27(20(2)3)30(41)37-24)19-21-12-14-23(15-13-21)31(32,33)34/h5-6,9,11-15,20,24-25,27,35H,4,7-8,10,16-19H2,1-3H3,(H,36,39)(H,37,41)(H,38,40)/t24-,25+,27+/m0/s1 |
| InChIKey | AXRILLAMGMVXTF-ZWEKWIFMSA-N |
| XLogP | 3.77 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.69 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |