C32H40ClN5O4S — CID 59277940
(6R,9R,12S)-6-[(3-chlorophenyl)methyl]-9-propan-2-yl-12-[2-(1,3-thiazol-2-yl)ethyl]-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione (PubChem CID 59277940) has the molecular formula C32H40ClN5O4S and a molecular weight of 626.22 g/mol. Its IUPAC name is (6R,9R,12S)-6-[(3-chlorophenyl)methyl]-9-propan-2-yl-12-[2-(1,3-thiazol-2-yl)ethyl]-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione.
| Compound Name | (6R,9R,12S)-6-[(3-chlorophenyl)methyl]-9-propan-2-yl-12-[2-(1,3-thiazol-2-yl)ethyl]-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
|---|---|
| PubChem CID | 59277940 |
| Molecular Formula | C32H40ClN5O4S |
| Molecular Weight | 626.22 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | (6R,9R,12S)-6-[(3-chlorophenyl)methyl]-9-propan-2-yl-12-[2-(1,3-thiazol-2-yl)ethyl]-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
| SMILES | CC(C)[C@H]1NC(=O)[C@@H](Cc2cccc(Cl)c2)NCCOc2ccccc2CCCNC(=O)[C@H](CCc2nccs2)NC1=O |
| InChI | InChI=1S/C32H40ClN5O4S/c1-21(2)29-32(41)37-25(12-13-28-35-16-18-43-28)30(39)36-14-6-9-23-8-3-4-11-27(23)42-17-15-34-26(31(40)38-29)20-22-7-5-10-24(33)19-22/h3-5,7-8,10-11,16,18-19,21,25-26,29,34H,6,9,12-15,17,20H2,1-2H3,(H,36,39)(H,37,41)(H,38,40)/t25-,26+,29+/m0/s1 |
| InChIKey | PTUSLTISRVUMDD-IWVFXYMLSA-N |
| XLogP | 3.70 |
| TPSA | 121.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.22 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |