C31H45N5O4 — CID 70899280
(6R,9R,12S)-12-[(dimethylamino)methyl]-6-[(3-methylphenyl)methyl]-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione (PubChem CID 70899280) has the molecular formula C31H45N5O4 and a molecular weight of 551.73 g/mol. Its IUPAC name is (6R,9R,12S)-12-[(dimethylamino)methyl]-6-[(3-methylphenyl)methyl]-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione.
| Compound Name | (6R,9R,12S)-12-[(dimethylamino)methyl]-6-[(3-methylphenyl)methyl]-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
|---|---|
| PubChem CID | 70899280 |
| Molecular Formula | C31H45N5O4 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.35 |
| IUPAC Name | (6R,9R,12S)-12-[(dimethylamino)methyl]-6-[(3-methylphenyl)methyl]-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
| SMILES | Cc1cccc(C[C@H]2NCCOc3ccccc3CCCNC(=O)[C@H](CN(C)C)NC(=O)[C@@H](C(C)C)NC2=O)c1 |
| InChI | InChI=1S/C31H45N5O4/c1-21(2)28-31(39)34-26(20-36(4)5)29(37)33-15-9-13-24-12-6-7-14-27(24)40-17-16-32-25(30(38)35-28)19-23-11-8-10-22(3)18-23/h6-8,10-12,14,18,21,25-26,28,32H,9,13,15-17,19-20H2,1-5H3,(H,33,37)(H,34,39)(H,35,38)/t25-,26+,28-/m1/s1 |
| InChIKey | FKAFPNPSDUDGTI-FULLSBAXSA-N |
| XLogP | 1.82 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |