C30H43N7O4 — CID 89080324
2-[[(6R,9R,12S)-6-[(3-methylphenyl)methyl]-7,10,13-trioxo-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-trien-12-yl]methyl]guanidine (PubChem CID 89080324) has the molecular formula C30H43N7O4 and a molecular weight of 565.72 g/mol. Its IUPAC name is 2-[[(6R,9R,12S)-6-[(3-methylphenyl)methyl]-7,10,13-trioxo-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-trien-12-yl]methyl]guanidine.
| Compound Name | 2-[[(6R,9R,12S)-6-[(3-methylphenyl)methyl]-7,10,13-trioxo-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-trien-12-yl]methyl]guanidine |
|---|---|
| PubChem CID | 89080324 |
| Molecular Formula | C30H43N7O4 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.34 |
| IUPAC Name | 2-[[(6R,9R,12S)-6-[(3-methylphenyl)methyl]-7,10,13-trioxo-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-trien-12-yl]methyl]guanidine |
| SMILES | Cc1cccc(C[C@H]2NCCOc3ccccc3CCCNC(=O)[C@H](CN=C(N)N)NC(=O)[C@@H](C(C)C)NC2=O)c1 |
| InChI | InChI=1S/C30H43N7O4/c1-19(2)26-29(40)36-24(18-35-30(31)32)27(38)34-13-7-11-22-10-4-5-12-25(22)41-15-14-33-23(28(39)37-26)17-21-9-6-8-20(3)16-21/h4-6,8-10,12,16,19,23-24,26,33H,7,11,13-15,17-18H2,1-3H3,(H,34,38)(H,36,40)(H,37,39)(H4,31,32,35)/t23-,24+,26-/m1/s1 |
| InChIKey | MMSPWCARSDCEFN-RMTZWNOUSA-N |
| XLogP | 0.54 |
| TPSA | 172.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|