About 5-(1,3-benzothiazol-5-yl)-N,N-dimethylpyridin-2-amine
5-(1,3-benzothiazol-5-yl)-N,N-dimethylpyridin-2-amine (PubChem CID 59282921) has the molecular formula C14H13N3S
and a molecular weight of 255.35 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-5-yl)-N,N-dimethylpyridin-2-amine.
Molecular Properties
| Compound Name | 5-(1,3-benzothiazol-5-yl)-N,N-dimethylpyridin-2-amine |
| PubChem CID | 59282921 |
| Molecular Formula | C14H13N3S |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 5-(1,3-benzothiazol-5-yl)-N,N-dimethylpyridin-2-amine |
| SMILES | CN(C)c1ccc(-c2ccc3scnc3c2)cn1 |
| InChI | InChI=1S/C14H13N3S/c1-17(2)14-6-4-11(8-15-14)10-3-5-13-12(7-10)16-9-18-13/h3-9H,1-2H3 |
| InChIKey | YLOMHCNVQKSFDK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1,3-benzothiazol-5-yl)-N,N-dimethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-benzothiazol-5-yl)-N,N-dimethylpyridin-2-amine?
The IUPAC name of 5-(1,3-benzothiazol-5-yl)-N,N-dimethylpyridin-2-amine (CID 59282921) is 5-(1,3-benzothiazol-5-yl)-N,N-dimethylpyridin-2-amine.
What is the SMILES notation for 5-(1,3-benzothiazol-5-yl)-N,N-dimethylpyridin-2-amine?
The canonical SMILES for 5-(1,3-benzothiazol-5-yl)-N,N-dimethylpyridin-2-amine is CN(C)c1ccc(-c2ccc3scnc3c2)cn1.
What is the InChIKey of 5-(1,3-benzothiazol-5-yl)-N,N-dimethylpyridin-2-amine?
The InChIKey is YLOMHCNVQKSFDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3S/c1-17(2)14-6-4-11(8-15-14)10-3-5-13-12(7-10)16-9-18-13/h3-9H,1-2H3.
What are the key properties of 5-(1,3-benzothiazol-5-yl)-N,N-dimethylpyridin-2-amine?
5-(1,3-benzothiazol-5-yl)-N,N-dimethylpyridin-2-amine has a molecular weight of 255.35 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-benzothiazol-5-yl)-N,N-dimethylpyridin-2-amine is sourced from PubChem (CID 59282921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).