C20H26N4O — CID 59285330
2-(15-methyl-5,9,15-triazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-1-piperidin-1-ylethanone (PubChem CID 59285330) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is 2-(15-methyl-5,9,15-triazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-1-piperidin-1-ylethanone.
| Compound Name | 2-(15-methyl-5,9,15-triazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 59285330 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-(15-methyl-5,9,15-triazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-1-piperidin-1-ylethanone |
| SMILES | CN1C2CCC1c1c(n(CC(=O)N3CCCCC3)c3ccncc13)C2 |
| InChI | InChI=1S/C20H26N4O/c1-22-14-5-6-17(22)20-15-12-21-8-7-16(15)24(18(20)11-14)13-19(25)23-9-3-2-4-10-23/h7-8,12,14,17H,2-6,9-11,13H2,1H3 |
| InChIKey | RBESKTAMQFJPTN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |