C20H21N3O2S — CID 67544305
5,15-dimethyl-9-pyridin-3-ylsulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene (PubChem CID 67544305) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 5,15-dimethyl-9-pyridin-3-ylsulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene.
| Compound Name | 5,15-dimethyl-9-pyridin-3-ylsulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
|---|---|
| PubChem CID | 67544305 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 5,15-dimethyl-9-pyridin-3-ylsulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
| SMILES | Cc1ccc2c(c1)c1c(n2S(=O)(=O)c2cccnc2)CC2CCC1N2C |
| InChI | InChI=1S/C20H21N3O2S/c1-13-5-7-17-16(10-13)20-18-8-6-14(22(18)2)11-19(20)23(17)26(24,25)15-4-3-9-21-12-15/h3-5,7,9-10,12,14,18H,6,8,11H2,1-2H3 |
| InChIKey | KDYFBXCYPAHLAB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |