C22H21F3N2O2S — CID 67543792
5,15-dimethyl-9-[4-(trifluoromethyl)phenyl]sulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene (PubChem CID 67543792) has the molecular formula C22H21F3N2O2S and a molecular weight of 434.48 g/mol. Its IUPAC name is 5,15-dimethyl-9-[4-(trifluoromethyl)phenyl]sulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene.
| Compound Name | 5,15-dimethyl-9-[4-(trifluoromethyl)phenyl]sulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
|---|---|
| PubChem CID | 67543792 |
| Molecular Formula | C22H21F3N2O2S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 5,15-dimethyl-9-[4-(trifluoromethyl)phenyl]sulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
| SMILES | Cc1ccc2c(c1)c1c(n2S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC2CCC1N2C |
| InChI | InChI=1S/C22H21F3N2O2S/c1-13-3-9-18-17(11-13)21-19-10-6-15(26(19)2)12-20(21)27(18)30(28,29)16-7-4-14(5-8-16)22(23,24)25/h3-5,7-9,11,15,19H,6,10,12H2,1-2H3 |
| InChIKey | WDYVXGUXHJKAOY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |