C19H25BrN2O6 — CID 59287158
1-O-tert-butyl 2-O-methyl (2S,4R)-4-[(3-bromophenyl)methylcarbamoyloxy]pyrrolidine-1,2-dicarboxylate (PubChem CID 59287158) has the molecular formula C19H25BrN2O6 and a molecular weight of 457.32 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R)-4-[(3-bromophenyl)methylcarbamoyloxy]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-[(3-bromophenyl)methylcarbamoyloxy]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 59287158 |
| Molecular Formula | C19H25BrN2O6 |
| Molecular Weight | 457.32 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-[(3-bromophenyl)methylcarbamoyloxy]pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](OC(=O)NCc2cccc(Br)c2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H25BrN2O6/c1-19(2,3)28-18(25)22-11-14(9-15(22)16(23)26-4)27-17(24)21-10-12-6-5-7-13(20)8-12/h5-8,14-15H,9-11H2,1-4H3,(H,21,24)/t14-,15+/m1/s1 |
| InChIKey | DJPLSFFTVDZTMO-CABCVRRESA-N |
| XLogP | 3.23 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|