C23H29Cl2N3O4 — CID 59296068
4-amino-N-[4-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-3-hydroxybutyl]-3-methoxybenzamide (PubChem CID 59296068) has the molecular formula C23H29Cl2N3O4 and a molecular weight of 482.41 g/mol. Its IUPAC name is 4-amino-N-[4-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-3-hydroxybutyl]-3-methoxybenzamide.
| Compound Name | 4-amino-N-[4-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-3-hydroxybutyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 59296068 |
| Molecular Formula | C23H29Cl2N3O4 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 4-amino-N-[4-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-3-hydroxybutyl]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCCC(O)CN2CCC(Oc3ccc(Cl)c(Cl)c3)CC2)ccc1N |
| InChI | InChI=1S/C23H29Cl2N3O4/c1-31-22-12-15(2-5-21(22)26)23(30)27-9-6-16(29)14-28-10-7-17(8-11-28)32-18-3-4-19(24)20(25)13-18/h2-5,12-13,16-17,29H,6-11,14,26H2,1H3,(H,27,30) |
| InChIKey | SWMHBNKGWSZZFY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|