C11H14ClFN4O2 — CID 59299583
8-chloro-3-(6-fluorohexyl)-7H-purine-2,6-dione (PubChem CID 59299583) has the molecular formula C11H14ClFN4O2 and a molecular weight of 288.71 g/mol. Its IUPAC name is 8-chloro-3-(6-fluorohexyl)-7H-purine-2,6-dione.
| Compound Name | 8-chloro-3-(6-fluorohexyl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 59299583 |
| Molecular Formula | C11H14ClFN4O2 |
| Molecular Weight | 288.71 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 8-chloro-3-(6-fluorohexyl)-7H-purine-2,6-dione |
| SMILES | O=c1[nH]c(=O)n(CCCCCCF)c2nc(Cl)[nH]c12 |
| InChI | InChI=1S/C11H14ClFN4O2/c12-10-14-7-8(15-10)17(11(19)16-9(7)18)6-4-2-1-3-5-13/h1-6H2,(H,14,15)(H,16,18,19) |
| InChIKey | ZZTKQNHOWORJOB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.71 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|