C15H17N3O3 — CID 59301022
5-amino-3,3-dimethyl-6-nitro-1-pent-3-ynylindol-2-one (PubChem CID 59301022) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 5-amino-3,3-dimethyl-6-nitro-1-pent-3-ynylindol-2-one.
| Compound Name | 5-amino-3,3-dimethyl-6-nitro-1-pent-3-ynylindol-2-one |
|---|---|
| PubChem CID | 59301022 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 5-amino-3,3-dimethyl-6-nitro-1-pent-3-ynylindol-2-one |
| SMILES | CC#CCCN1C(=O)C(C)(C)c2cc(N)c([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C15H17N3O3/c1-4-5-6-7-17-12-9-13(18(20)21)11(16)8-10(12)15(2,3)14(17)19/h8-9H,6-7,16H2,1-3H3 |
| InChIKey | JBASDQOLRQNEID-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|