C36H56N6O4 — CID 69492299
6-amino-3,3-dimethyl-1-pentyl-5-(propan-2-ylamino)indol-2-one;3,3-dimethyl-6-nitro-1-pentyl-5-(propan-2-ylamino)indol-2-one (PubChem CID 69492299) has the molecular formula C36H56N6O4 and a molecular weight of 636.88 g/mol. Its IUPAC name is 6-amino-3,3-dimethyl-1-pentyl-5-(propan-2-ylamino)indol-2-one;3,3-dimethyl-6-nitro-1-pentyl-5-(propan-2-ylamino)indol-2-one.
| Compound Name | 6-amino-3,3-dimethyl-1-pentyl-5-(propan-2-ylamino)indol-2-one;3,3-dimethyl-6-nitro-1-pentyl-5-(propan-2-ylamino)indol-2-one |
|---|---|
| PubChem CID | 69492299 |
| Molecular Formula | C36H56N6O4 |
| Molecular Weight | 636.88 g/mol |
| Exact Mass | 636.44 |
| IUPAC Name | 6-amino-3,3-dimethyl-1-pentyl-5-(propan-2-ylamino)indol-2-one;3,3-dimethyl-6-nitro-1-pentyl-5-(propan-2-ylamino)indol-2-one |
| SMILES | CCCCCN1C(=O)C(C)(C)c2cc(NC(C)C)c(N)cc21.CCCCCN1C(=O)C(C)(C)c2cc(NC(C)C)c([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C18H27N3O3.C18H29N3O/c1-6-7-8-9-20-15-11-16(21(23)24)14(19-12(2)3)10-13(15)18(4,5)17(20)22;1-6-7-8-9-21-16-11-14(19)15(20-12(2)3)10-13(16)18(4,5)17(21)22/h10-12,19H,6-9H2,1-5H3;10-12,20H,6-9,19H2,1-5H3 |
| InChIKey | ZVAXAKRMSKASQX-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.88 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|