C12H7Cl2N3O — CID 59312899
7-(2,4-dichlorophenyl)-6H-imidazo[1,2-c]pyrimidin-5-one (PubChem CID 59312899) has the molecular formula C12H7Cl2N3O and a molecular weight of 280.11 g/mol. Its IUPAC name is 7-(2,4-dichlorophenyl)-6H-imidazo[1,2-c]pyrimidin-5-one.
| Compound Name | 7-(2,4-dichlorophenyl)-6H-imidazo[1,2-c]pyrimidin-5-one |
|---|---|
| PubChem CID | 59312899 |
| Molecular Formula | C12H7Cl2N3O |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 7-(2,4-dichlorophenyl)-6H-imidazo[1,2-c]pyrimidin-5-one |
| SMILES | O=c1[nH]c(-c2ccc(Cl)cc2Cl)cc2nccn12 |
| InChI | InChI=1S/C12H7Cl2N3O/c13-7-1-2-8(9(14)5-7)10-6-11-15-3-4-17(11)12(18)16-10/h1-6H,(H,16,18) |
| InChIKey | XERUFHXDRXECGS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |