C18H25N3O3 — CID 59315535
tert-butyl N-[[5-amino-2-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]methyl]-N-methylcarbamate (PubChem CID 59315535) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is tert-butyl N-[[5-amino-2-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[5-amino-2-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 59315535 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | tert-butyl N-[[5-amino-2-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]methyl]-N-methylcarbamate |
| SMILES | Cc1noc(C)c1-c1ccc(N)cc1CN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25N3O3/c1-11-16(12(2)24-20-11)15-8-7-14(19)9-13(15)10-21(6)17(22)23-18(3,4)5/h7-9H,10,19H2,1-6H3 |
| InChIKey | TYKSCGUDZLXACR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|