C22H19F3N2O2 — CID 59316443
3-[4-[[[2-(trifluoromethoxy)phenyl]methylamino]methyl]phenyl]benzamide (PubChem CID 59316443) has the molecular formula C22H19F3N2O2 and a molecular weight of 400.40 g/mol. Its IUPAC name is 3-[4-[[[2-(trifluoromethoxy)phenyl]methylamino]methyl]phenyl]benzamide.
| Compound Name | 3-[4-[[[2-(trifluoromethoxy)phenyl]methylamino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 59316443 |
| Molecular Formula | C22H19F3N2O2 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 3-[4-[[[2-(trifluoromethoxy)phenyl]methylamino]methyl]phenyl]benzamide |
| SMILES | NC(=O)c1cccc(-c2ccc(CNCc3ccccc3OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C22H19F3N2O2/c23-22(24,25)29-20-7-2-1-4-19(20)14-27-13-15-8-10-16(11-9-15)17-5-3-6-18(12-17)21(26)28/h1-12,27H,13-14H2,(H2,26,28) |
| InChIKey | YBQTWSZLRMFGGV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |