C21H20ClFN2O — CID 68604070
3-[4-[[(2-fluorophenyl)methylamino]methyl]phenyl]benzamide;hydrochloride (PubChem CID 68604070) has the molecular formula C21H20ClFN2O and a molecular weight of 370.86 g/mol. Its IUPAC name is 3-[4-[[(2-fluorophenyl)methylamino]methyl]phenyl]benzamide;hydrochloride.
| Compound Name | 3-[4-[[(2-fluorophenyl)methylamino]methyl]phenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 68604070 |
| Molecular Formula | C21H20ClFN2O |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 3-[4-[[(2-fluorophenyl)methylamino]methyl]phenyl]benzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1cccc(-c2ccc(CNCc3ccccc3F)cc2)c1 |
| InChI | InChI=1S/C21H19FN2O.ClH/c22-20-7-2-1-4-19(20)14-24-13-15-8-10-16(11-9-15)17-5-3-6-18(12-17)21(23)25;/h1-12,24H,13-14H2,(H2,23,25);1H |
| InChIKey | HTUMKORCEJIVDE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |