C23H21F3N2O — CID 87232301
3-[4-[[2-(2,4,5-trifluoro-3-methylphenyl)ethylamino]methyl]phenyl]benzamide (PubChem CID 87232301) has the molecular formula C23H21F3N2O and a molecular weight of 398.43 g/mol. Its IUPAC name is 3-[4-[[2-(2,4,5-trifluoro-3-methylphenyl)ethylamino]methyl]phenyl]benzamide.
| Compound Name | 3-[4-[[2-(2,4,5-trifluoro-3-methylphenyl)ethylamino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 87232301 |
| Molecular Formula | C23H21F3N2O |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 3-[4-[[2-(2,4,5-trifluoro-3-methylphenyl)ethylamino]methyl]phenyl]benzamide |
| SMILES | Cc1c(F)c(F)cc(CCNCc2ccc(-c3cccc(C(N)=O)c3)cc2)c1F |
| InChI | InChI=1S/C23H21F3N2O/c1-14-21(25)18(12-20(24)22(14)26)9-10-28-13-15-5-7-16(8-6-15)17-3-2-4-19(11-17)23(27)29/h2-8,11-12,28H,9-10,13H2,1H3,(H2,27,29) |
| InChIKey | NPRINQIPSJUMOR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|