C25H35N — CID 59318260
N-[2,6-di(propan-2-yl)phenyl]-1-[2-(2-methylprop-2-enyl)-2-bicyclo[2.2.1]hept-5-enyl]ethanimine (PubChem CID 59318260) has the molecular formula C25H35N and a molecular weight of 349.56 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-1-[2-(2-methylprop-2-enyl)-2-bicyclo[2.2.1]hept-5-enyl]ethanimine.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-1-[2-(2-methylprop-2-enyl)-2-bicyclo[2.2.1]hept-5-enyl]ethanimine |
|---|---|
| PubChem CID | 59318260 |
| Molecular Formula | C25H35N |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.28 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-1-[2-(2-methylprop-2-enyl)-2-bicyclo[2.2.1]hept-5-enyl]ethanimine |
| SMILES | C=C(C)CC1(/C(C)=N/c2c(C(C)C)cccc2C(C)C)CC2C=CC1C2 |
| InChI | InChI=1S/C25H35N/c1-16(2)14-25(15-20-11-12-21(25)13-20)19(7)26-24-22(17(3)4)9-8-10-23(24)18(5)6/h8-12,17-18,20-21H,1,13-15H2,2-7H3/b26-19+ |
| InChIKey | BDDFMTCMLKAJBR-LGUFXXKBSA-N |
| XLogP | 7.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|