C15H29NO — CID 59319513
5,6-ditert-butyl-1-methyl-2,3,4,7-tetrahydroazepin-7-ol (PubChem CID 59319513) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is 5,6-ditert-butyl-1-methyl-2,3,4,7-tetrahydroazepin-7-ol.
| Compound Name | 5,6-ditert-butyl-1-methyl-2,3,4,7-tetrahydroazepin-7-ol |
|---|---|
| PubChem CID | 59319513 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | 5,6-ditert-butyl-1-methyl-2,3,4,7-tetrahydroazepin-7-ol |
| SMILES | CN1CCCC(C(C)(C)C)=C(C(C)(C)C)C1O |
| InChI | InChI=1S/C15H29NO/c1-14(2,3)11-9-8-10-16(7)13(17)12(11)15(4,5)6/h13,17H,8-10H2,1-7H3 |
| InChIKey | NFMKCYJKZFGXDO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|