C16H30S — CID 129196684
2,3,4-tritert-butyl-2,5-dihydrothiophene (PubChem CID 129196684) has the molecular formula C16H30S and a molecular weight of 254.48 g/mol. Its IUPAC name is 2,3,4-tritert-butyl-2,5-dihydrothiophene.
| Compound Name | 2,3,4-tritert-butyl-2,5-dihydrothiophene |
|---|---|
| PubChem CID | 129196684 |
| Molecular Formula | C16H30S |
| Molecular Weight | 254.48 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | 2,3,4-tritert-butyl-2,5-dihydrothiophene |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)C(C(C)(C)C)SC1 |
| InChI | InChI=1S/C16H30S/c1-14(2,3)11-10-17-13(16(7,8)9)12(11)15(4,5)6/h13H,10H2,1-9H3 |
| InChIKey | LDNYOJBEULPNRU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|