C17H30S — CID 2751847
3,3,5,5-tetramethyl-4-(2,2,4,4-tetramethylcyclobutylidene)thiane (PubChem CID 2751847) has the molecular formula C17H30S and a molecular weight of 266.49 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-4-(2,2,4,4-tetramethylcyclobutylidene)thiane.
| Compound Name | 3,3,5,5-tetramethyl-4-(2,2,4,4-tetramethylcyclobutylidene)thiane |
|---|---|
| PubChem CID | 2751847 |
| Molecular Formula | C17H30S |
| Molecular Weight | 266.49 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 3,3,5,5-tetramethyl-4-(2,2,4,4-tetramethylcyclobutylidene)thiane |
| SMILES | CC1(C)CSCC(C)(C)C1=C1C(C)(C)CC1(C)C |
| InChI | InChI=1S/C17H30S/c1-14(2)9-15(3,4)12(14)13-16(5,6)10-18-11-17(13,7)8/h9-11H2,1-8H3 |
| InChIKey | CBKGVEOKSBEETB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|