C30H36FN3O2 — CID 59323316
tert-butyl N-[(4-aminophenyl)methyl]-N-[2-[3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]carbamate (PubChem CID 59323316) has the molecular formula C30H36FN3O2 and a molecular weight of 489.64 g/mol. Its IUPAC name is tert-butyl N-[(4-aminophenyl)methyl]-N-[2-[3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(4-aminophenyl)methyl]-N-[2-[3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 59323316 |
| Molecular Formula | C30H36FN3O2 |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | tert-butyl N-[(4-aminophenyl)methyl]-N-[2-[3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCN1Cc2ccccc2CC1Cc1ccc(F)cc1)Cc1ccc(N)cc1 |
| InChI | InChI=1S/C30H36FN3O2/c1-30(2,3)36-29(35)34(20-23-10-14-27(32)15-11-23)17-16-33-21-25-7-5-4-6-24(25)19-28(33)18-22-8-12-26(31)13-9-22/h4-15,28H,16-21,32H2,1-3H3 |
| InChIKey | MYBOKEWCFOMDKI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|