C17H23N2S+ — CID 59324088
4-heptyl-1-methyl-[1,3]thiazolo[3,2-a]benzimidazol-4-ium (PubChem CID 59324088) has the molecular formula C17H23N2S+ and a molecular weight of 287.45 g/mol. Its IUPAC name is 4-heptyl-1-methyl-[1,3]thiazolo[3,2-a]benzimidazol-4-ium.
| Compound Name | 4-heptyl-1-methyl-[1,3]thiazolo[3,2-a]benzimidazol-4-ium |
|---|---|
| PubChem CID | 59324088 |
| Molecular Formula | C17H23N2S+ |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 4-heptyl-1-methyl-[1,3]thiazolo[3,2-a]benzimidazol-4-ium |
| SMILES | CCCCCCC[n+]1c2ccccc2n2c(C)csc21 |
| InChI | InChI=1S/C17H23N2S/c1-3-4-5-6-9-12-18-15-10-7-8-11-16(15)19-14(2)13-20-17(18)19/h7-8,10-11,13H,3-6,9,12H2,1-2H3/q+1 |
| InChIKey | JQTKROVEIPFTBV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|