C21H31IN2S — CID 66779183
1-(3-heptyl-2-methyl-1,3-thiazol-3-ium-4-yl)-N,N-dimethyl-2-phenylethenamine iodide (PubChem CID 66779183) has the molecular formula C21H31IN2S and a molecular weight of 470.46 g/mol. Its IUPAC name is 1-(3-heptyl-2-methyl-1,3-thiazol-3-ium-4-yl)-N,N-dimethyl-2-phenylethenamine iodide.
| Compound Name | 1-(3-heptyl-2-methyl-1,3-thiazol-3-ium-4-yl)-N,N-dimethyl-2-phenylethenamine iodide |
|---|---|
| PubChem CID | 66779183 |
| Molecular Formula | C21H31IN2S |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 1-(3-heptyl-2-methyl-1,3-thiazol-3-ium-4-yl)-N,N-dimethyl-2-phenylethenamine iodide |
| SMILES | CCCCCCC[n+]1c(C(=Cc2ccccc2)N(C)C)csc1C.[I-] |
| InChI | InChI=1S/C21H31N2S.HI/c1-5-6-7-8-12-15-23-18(2)24-17-21(23)20(22(3)4)16-19-13-10-9-11-14-19;/h9-11,13-14,16-17H,5-8,12,15H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | AIUVUXNUYVIDRV-UHFFFAOYSA-M |
| XLogP | 2.38 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|