C36H36O6 — CID 59324348
[4-[[4-[1-(4-methoxyphenyl)-2H-acenaphthylen-1-yl]phenoxy]carbonyloxymethyl]cyclohexyl]methyl acetate (PubChem CID 59324348) has the molecular formula C36H36O6 and a molecular weight of 564.68 g/mol. Its IUPAC name is [4-[[4-[1-(4-methoxyphenyl)-2H-acenaphthylen-1-yl]phenoxy]carbonyloxymethyl]cyclohexyl]methyl acetate.
| Compound Name | [4-[[4-[1-(4-methoxyphenyl)-2H-acenaphthylen-1-yl]phenoxy]carbonyloxymethyl]cyclohexyl]methyl acetate |
|---|---|
| PubChem CID | 59324348 |
| Molecular Formula | C36H36O6 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | [4-[[4-[1-(4-methoxyphenyl)-2H-acenaphthylen-1-yl]phenoxy]carbonyloxymethyl]cyclohexyl]methyl acetate |
| SMILES | COc1ccc(C2(c3ccc(OC(=O)OCC4CCC(COC(C)=O)CC4)cc3)Cc3cccc4cccc2c34)cc1 |
| InChI | InChI=1S/C36H36O6/c1-24(37)40-22-25-9-11-26(12-10-25)23-41-35(38)42-32-19-15-30(16-20-32)36(29-13-17-31(39-2)18-14-29)21-28-7-3-5-27-6-4-8-33(36)34(27)28/h3-8,13-20,25-26H,9-12,21-23H2,1-2H3 |
| InChIKey | UINGWYAUXJTQLM-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|