C26H22O4 — CID 72802652
1,2-bis(4-methoxyphenyl)acenaphthylene-1,2-diol (PubChem CID 72802652) has the molecular formula C26H22O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 1,2-bis(4-methoxyphenyl)acenaphthylene-1,2-diol.
| Compound Name | 1,2-bis(4-methoxyphenyl)acenaphthylene-1,2-diol |
|---|---|
| PubChem CID | 72802652 |
| Molecular Formula | C26H22O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 1,2-bis(4-methoxyphenyl)acenaphthylene-1,2-diol |
| SMILES | COc1ccc(C2(O)c3cccc4cccc(c34)C2(O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H22O4/c1-29-20-13-9-18(10-14-20)25(27)22-7-3-5-17-6-4-8-23(24(17)22)26(25,28)19-11-15-21(30-2)16-12-19/h3-16,27-28H,1-2H3 |
| InChIKey | DUIPUKVZXGMKNV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |