C34H32N2O — CID 5250946
2,2-bis[4-(dimethylamino)phenyl]-1-phenylacenaphthylen-1-ol (PubChem CID 5250946) has the molecular formula C34H32N2O and a molecular weight of 484.64 g/mol. Its IUPAC name is 2,2-bis[4-(dimethylamino)phenyl]-1-phenylacenaphthylen-1-ol.
| Compound Name | 2,2-bis[4-(dimethylamino)phenyl]-1-phenylacenaphthylen-1-ol |
|---|---|
| PubChem CID | 5250946 |
| Molecular Formula | C34H32N2O |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 2,2-bis[4-(dimethylamino)phenyl]-1-phenylacenaphthylen-1-ol |
| SMILES | CN(C)c1ccc(C2(c3ccc(N(C)C)cc3)c3cccc4cccc(c34)C2(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H32N2O/c1-35(2)28-20-16-25(17-21-28)33(26-18-22-29(23-19-26)36(3)4)30-14-8-10-24-11-9-15-31(32(24)30)34(33,37)27-12-6-5-7-13-27/h5-23,37H,1-4H3 |
| InChIKey | CTYABJFNMHQUMG-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|