C15H18O4 — CID 59325866
2-methyl-3-[6-(2-methyl-3-oxopropyl)-1,3-benzodioxol-5-yl]propanal (PubChem CID 59325866) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-methyl-3-[6-(2-methyl-3-oxopropyl)-1,3-benzodioxol-5-yl]propanal.
| Compound Name | 2-methyl-3-[6-(2-methyl-3-oxopropyl)-1,3-benzodioxol-5-yl]propanal |
|---|---|
| PubChem CID | 59325866 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-methyl-3-[6-(2-methyl-3-oxopropyl)-1,3-benzodioxol-5-yl]propanal |
| SMILES | CC(C=O)Cc1cc2c(cc1CC(C)C=O)OCO2 |
| InChI | InChI=1S/C15H18O4/c1-10(7-16)3-12-5-14-15(19-9-18-14)6-13(12)4-11(2)8-17/h5-8,10-11H,3-4,9H2,1-2H3 |
| InChIKey | NHRNWYHPNUGEDV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|