C29H30N4O3 — CID 59331128
hex-5-ynyl 4-[[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]methyl]benzoate (PubChem CID 59331128) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is hex-5-ynyl 4-[[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]methyl]benzoate.
| Compound Name | hex-5-ynyl 4-[[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 59331128 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | hex-5-ynyl 4-[[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]methyl]benzoate |
| SMILES | C#CCCCCOC(=O)c1ccc(CNC(=O)c2ccc(/N=N/c3ccc(N(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H30N4O3/c1-4-5-6-7-20-36-29(35)24-10-8-22(9-11-24)21-30-28(34)23-12-14-25(15-13-23)31-32-26-16-18-27(19-17-26)33(2)3/h1,8-19H,5-7,20-21H2,2-3H3,(H,30,34)/b32-31+ |
| InChIKey | SPBUQFLSWYQVMO-QNEJGDQOSA-N |
| XLogP | 6.06 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|